ChemNet > CAS > 175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid
175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid
| اسم المنتج |
2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid |
| الاسم المستعار |
2-[(6-methoxy-3-nitropyridin-2-yl)sulfanyl]propanoic acid |
| الصيغة الجزيئية |
C9H10N2O5S |
| الوزن الجزيئي الغرامي |
258.2511 |
| InChI |
InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13) |
| إستراتيجية المساعدة القطرية |
175205-01-3 |
| بنية جزيئية |
![175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid](https://images-a.chemnet.com/suppliers/chembase/314/31465.gif)
|
| كثافة |
1.47g/cm3 |
| درجة الإنصهار |
196℃ |
| نقطة الغليان |
434.5°C at 760 mmHg |
| معامل الإنكسار |
1.605 |
| نقطة الوميض |
216.6°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
